C21H16FN3S — CID 2358983
3-benzylsulfanyl-5-(4-fluorophenyl)-4-phenyl-1,2,4-triazole (PubChem CID 2358983) has the molecular formula C21H16FN3S and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-benzylsulfanyl-5-(4-fluorophenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-5-(4-fluorophenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 2358983 |
| Molecular Formula | C21H16FN3S |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 3-benzylsulfanyl-5-(4-fluorophenyl)-4-phenyl-1,2,4-triazole |
| SMILES | Fc1ccc(-c2nnc(SCc3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16FN3S/c22-18-13-11-17(12-14-18)20-23-24-21(25(20)19-9-5-2-6-10-19)26-15-16-7-3-1-4-8-16/h1-14H,15H2 |
| InChIKey | PPSADBJBFLAJSL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |