C27H23N3O3 — CID 23589888
N-(2-hydroxy-1-phenylethyl)-6-methoxy-3-naphthalen-2-yl-1H-indazole-5-carboxamide (PubChem CID 23589888) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-6-methoxy-3-naphthalen-2-yl-1H-indazole-5-carboxamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-6-methoxy-3-naphthalen-2-yl-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 23589888 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-6-methoxy-3-naphthalen-2-yl-1H-indazole-5-carboxamide |
| SMILES | COc1cc2[nH]nc(-c3ccc4ccccc4c3)c2cc1C(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O3/c1-33-25-15-23-21(14-22(25)27(32)28-24(16-31)18-8-3-2-4-9-18)26(30-29-23)20-12-11-17-7-5-6-10-19(17)13-20/h2-15,24,31H,16H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | GEZSSIXQBHJKNB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |