C19H36N2O2 — CID 23590157
1-N,2-N-diheptylcyclopropane-1,2-dicarboxamide (PubChem CID 23590157) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-N,2-N-diheptylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-diheptylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 23590157 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-N,2-N-diheptylcyclopropane-1,2-dicarboxamide |
| SMILES | CCCCCCCNC(=O)C1CC1C(=O)NCCCCCCC |
| InChI | InChI=1S/C19H36N2O2/c1-3-5-7-9-11-13-20-18(22)16-15-17(16)19(23)21-14-12-10-8-6-4-2/h16-17H,3-15H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZMOKKXITIZPPHM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|