C19H16N3+ — CID 23590331
2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene (PubChem CID 23590331) has the molecular formula C19H16N3+ and a molecular weight of 286.36 g/mol. Its IUPAC name is 2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene.
| Compound Name | 2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene |
|---|---|
| PubChem CID | 23590331 |
| Molecular Formula | C19H16N3+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene |
| SMILES | C1=[N+](c2ccccc2)C2N(c3ccccc3)Cc3ccc1n32 |
| InChI | InChI=1S/C19H16N3/c1-3-7-15(8-4-1)20-13-17-11-12-18-14-21(19(20)22(17)18)16-9-5-2-6-10-16/h1-13,19H,14H2/q+1 |
| InChIKey | VNGQZVIGYQZAHD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 11.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|