C23H22N4O4S — CID 2359068
N-(1H-indazol-6-yl)-2-[4-[methyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide (PubChem CID 2359068) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-2-[4-[methyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide.
| Compound Name | N-(1H-indazol-6-yl)-2-[4-[methyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 2359068 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(1H-indazol-6-yl)-2-[4-[methyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(OCC(=O)Nc3ccc4cn[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-16-3-11-21(12-4-16)32(29,30)27(2)19-7-9-20(10-8-19)31-15-23(28)25-18-6-5-17-14-24-26-22(17)13-18/h3-14H,15H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | BDBDZLDBXQSAEY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |