C22H27F11O — CID 23591053
3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 23591053) has the molecular formula C22H27F11O and a molecular weight of 516.44 g/mol. Its IUPAC name is 3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | 3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 23591053 |
| Molecular Formula | C22H27F11O |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | OC(C(C/C=C/C1CCC(C2CCCCC2)CC1)C(F)(F)C(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H27F11O/c23-17(18(24)25)19(26,27)16(20(34,21(28,29)30)22(31,32)33)8-4-5-13-9-11-15(12-10-13)14-6-2-1-3-7-14/h4-5,13-16,34H,1-3,6-12H2/b5-4+ |
| InChIKey | KXCBJDGXLCRBSZ-SNAWJCMRSA-N |
| XLogP | 8.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|