C22H29F9O — CID 23591054
3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 23591054) has the molecular formula C22H29F9O and a molecular weight of 480.46 g/mol. Its IUPAC name is 3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | 3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 23591054 |
| Molecular Formula | C22H29F9O |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | OC(C(C/C=C/C1CCC(C2CCCCC2)CC1)CC(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H29F9O/c23-18(19(24)25)13-17(20(32,21(26,27)28)22(29,30)31)8-4-5-14-9-11-16(12-10-14)15-6-2-1-3-7-15/h4-5,14-17,32H,1-3,6-13H2/b5-4+ |
| InChIKey | UCJOEBCBBSKRGA-SNAWJCMRSA-N |
| XLogP | 8.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|