C16H19F9O — CID 23591056
3-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 23591056) has the molecular formula C16H19F9O and a molecular weight of 398.31 g/mol. Its IUPAC name is 3-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | 3-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 23591056 |
| Molecular Formula | C16H19F9O |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,6,6-hexafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | OC(C(C/C=C/C1CCCCC1)CC(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H19F9O/c17-12(13(18)19)9-11(8-4-7-10-5-2-1-3-6-10)14(26,15(20,21)22)16(23,24)25/h4,7,10-11,26H,1-3,5-6,8-9H2/b7-4+ |
| InChIKey | RAQOVCXCOWGANG-QPJJXVBHSA-N |
| XLogP | 6.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|