C23H29F11O — CID 23591065
4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 23591065) has the molecular formula C23H29F11O and a molecular weight of 530.46 g/mol. Its IUPAC name is 4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 23591065 |
| Molecular Formula | C23H29F11O |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | OC(CC(C/C=C/C1CCC(C2CCCCC2)CC1)C(F)(F)C(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H29F11O/c24-18(19(25)26)21(27,28)17(13-20(35,22(29,30)31)23(32,33)34)8-4-5-14-9-11-16(12-10-14)15-6-2-1-3-7-15/h4-5,14-17,35H,1-3,6-13H2/b5-4+ |
| InChIKey | QUKTYNLFFOJXGN-SNAWJCMRSA-N |
| XLogP | 8.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|