C23H31F9O — CID 23591066
4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 23591066) has the molecular formula C23H31F9O and a molecular weight of 494.48 g/mol. Its IUPAC name is 4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 23591066 |
| Molecular Formula | C23H31F9O |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-[(E)-3-(4-cyclohexylcyclohexyl)prop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | OC(CC(C/C=C/C1CCC(C2CCCCC2)CC1)CC(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H31F9O/c24-19(20(25)26)13-16(14-21(33,22(27,28)29)23(30,31)32)6-4-5-15-9-11-18(12-10-15)17-7-2-1-3-8-17/h4-5,15-18,33H,1-3,6-14H2/b5-4+ |
| InChIKey | DSHMDNDEQSGLII-SNAWJCMRSA-N |
| XLogP | 8.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|