C17H21F9O — CID 23591068
4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 23591068) has the molecular formula C17H21F9O and a molecular weight of 412.34 g/mol. Its IUPAC name is 4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 23591068 |
| Molecular Formula | C17H21F9O |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,6,7,7-hexafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | OC(CC(C/C=C/C1CCCCC1)CC(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H21F9O/c18-13(14(19)20)9-12(8-4-7-11-5-2-1-3-6-11)10-15(27,16(21,22)23)17(24,25)26/h4,7,11-12,27H,1-3,5-6,8-10H2/b7-4+ |
| InChIKey | KIKTVZWCQZHDJZ-QPJJXVBHSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|