C14H16F8O — CID 23591073
6-cyclohexyl-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 23591073) has the molecular formula C14H16F8O and a molecular weight of 352.27 g/mol. Its IUPAC name is 6-cyclohexyl-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | 6-cyclohexyl-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 23591073 |
| Molecular Formula | C14H16F8O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 6-cyclohexyl-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | C=C(CC(O)(C(F)(F)F)C(F)(F)C(F)=C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C14H16F8O/c1-8(9-5-3-2-4-6-9)7-12(23,14(20,21)22)13(18,19)10(15)11(16)17/h9,23H,1-7H2 |
| InChIKey | YOZLXWGEJVHILB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|