C20H26F8O — CID 23591077
(6E)-7-(4-cyclohexylcyclohexyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 23591077) has the molecular formula C20H26F8O and a molecular weight of 434.41 g/mol. Its IUPAC name is (6E)-7-(4-cyclohexylcyclohexyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | (6E)-7-(4-cyclohexylcyclohexyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 23591077 |
| Molecular Formula | C20H26F8O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (6E)-7-(4-cyclohexylcyclohexyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | OC(C/C=C/C1CCC(C2CCCCC2)CC1)(C(F)(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C20H26F8O/c21-16(17(22)23)19(24,25)18(29,20(26,27)28)12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14/h4-5,13-15,29H,1-3,6-12H2/b5-4+ |
| InChIKey | NQVFNHWVSLIACA-SNAWJCMRSA-N |
| XLogP | 7.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|