C20H28F6O — CID 23591078
(6E)-7-(4-cyclohexylcyclohexyl)-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 23591078) has the molecular formula C20H28F6O and a molecular weight of 398.43 g/mol. Its IUPAC name is (6E)-7-(4-cyclohexylcyclohexyl)-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | (6E)-7-(4-cyclohexylcyclohexyl)-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 23591078 |
| Molecular Formula | C20H28F6O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (6E)-7-(4-cyclohexylcyclohexyl)-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | OC(C/C=C/C1CCC(C2CCCCC2)CC1)(CC(F)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H28F6O/c21-17(18(22)23)13-19(27,20(24,25)26)12-4-5-14-8-10-16(11-9-14)15-6-2-1-3-7-15/h4-5,14-16,27H,1-3,6-13H2/b5-4+ |
| InChIKey | ABNUIUJELPNNNA-SNAWJCMRSA-N |
| XLogP | 7.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|