C12H14F3NO8S2 — CID 23591330
[(Z)-[2,2,2-trifluoro-1-[4-(3-sulfooxypropoxy)phenyl]ethylidene]amino] methanesulfonate (PubChem CID 23591330) has the molecular formula C12H14F3NO8S2 and a molecular weight of 421.37 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-(3-sulfooxypropoxy)phenyl]ethylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-(3-sulfooxypropoxy)phenyl]ethylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 23591330 |
| Molecular Formula | C12H14F3NO8S2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-(3-sulfooxypropoxy)phenyl]ethylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)O/N=C(/c1ccc(OCCCOS(=O)(=O)O)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO8S2/c1-25(17,18)24-16-11(12(13,14)15)9-3-5-10(6-4-9)22-7-2-8-23-26(19,20)21/h3-6H,2,7-8H2,1H3,(H,19,20,21)/b16-11- |
| InChIKey | PEGUJXGFRGQLJH-WJDWOHSUSA-N |
| XLogP | 1.52 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|