C21H16N2O4 — CID 23591709
1,5-diamino-4,8-dihydroxy-2-(4-methylphenyl)anthracene-9,10-dione (PubChem CID 23591709) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1,5-diamino-4,8-dihydroxy-2-(4-methylphenyl)anthracene-9,10-dione.
| Compound Name | 1,5-diamino-4,8-dihydroxy-2-(4-methylphenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 23591709 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1,5-diamino-4,8-dihydroxy-2-(4-methylphenyl)anthracene-9,10-dione |
| SMILES | Cc1ccc(-c2cc(O)c3c(c2N)C(=O)c2c(O)ccc(N)c2C3=O)cc1 |
| InChI | InChI=1S/C21H16N2O4/c1-9-2-4-10(5-3-9)11-8-14(25)17-18(19(11)23)21(27)16-13(24)7-6-12(22)15(16)20(17)26/h2-8,24-25H,22-23H2,1H3 |
| InChIKey | GWIOMRQWBXWCNP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|