C7H9F6N — CID 23591723
2,2,3,4,5,5-hexafluoro-1,3,4-trimethylpyrrolidine (PubChem CID 23591723) has the molecular formula C7H9F6N and a molecular weight of 221.14 g/mol. Its IUPAC name is 2,2,3,4,5,5-hexafluoro-1,3,4-trimethylpyrrolidine.
| Compound Name | 2,2,3,4,5,5-hexafluoro-1,3,4-trimethylpyrrolidine |
|---|---|
| PubChem CID | 23591723 |
| Molecular Formula | C7H9F6N |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2,2,3,4,5,5-hexafluoro-1,3,4-trimethylpyrrolidine |
| SMILES | CN1C(F)(F)C(C)(F)C(C)(F)C1(F)F |
| InChI | InChI=1S/C7H9F6N/c1-4(8)5(2,9)7(12,13)14(3)6(4,10)11/h1-3H3 |
| InChIKey | HYUCIPGHXROLLH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|