C26H34N2O6 — CID 23591738
methyl 6-amino-2-[3-[4-(3,4-dimethoxyphenoxy)phenyl]-3-methyl-2-oxopyrrolidin-1-yl]hexanoate (PubChem CID 23591738) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is methyl 6-amino-2-[3-[4-(3,4-dimethoxyphenoxy)phenyl]-3-methyl-2-oxopyrrolidin-1-yl]hexanoate.
| Compound Name | methyl 6-amino-2-[3-[4-(3,4-dimethoxyphenoxy)phenyl]-3-methyl-2-oxopyrrolidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 23591738 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | methyl 6-amino-2-[3-[4-(3,4-dimethoxyphenoxy)phenyl]-3-methyl-2-oxopyrrolidin-1-yl]hexanoate |
| SMILES | COC(=O)C(CCCCN)N1CCC(C)(c2ccc(Oc3ccc(OC)c(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C26H34N2O6/c1-26(14-16-28(25(26)30)21(24(29)33-4)7-5-6-15-27)18-8-10-19(11-9-18)34-20-12-13-22(31-2)23(17-20)32-3/h8-13,17,21H,5-7,14-16,27H2,1-4H3 |
| InChIKey | JOEINVCDMMFYAQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|