About 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone
2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone (PubChem CID 2359179) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone |
| PubChem CID | 2359179 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)C2=COCCO2)CC1 |
| InChI | InChI=1S/C11H18N2O3/c1-2-12-3-5-13(6-4-12)11(14)10-9-15-7-8-16-10/h9H,2-8H2,1H3 |
| InChIKey | JEVZRSMEUHZYNZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone?
The IUPAC name of 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone (CID 2359179) is 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone.
What is the SMILES notation for 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone?
The canonical SMILES for 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone is CCN1CCN(C(=O)C2=COCCO2)CC1.
What is the InChIKey of 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone?
The InChIKey is JEVZRSMEUHZYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-2-12-3-5-13(6-4-12)11(14)10-9-15-7-8-16-10/h9H,2-8H2,1H3.
What are the key properties of 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone?
2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone has a molecular weight of 226.28 g/mol, XLogP of 0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-dioxin-5-yl-(4-ethylpiperazin-1-yl)methanone is sourced from PubChem (CID 2359179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).