About 1,4-ditert-butylpiperidine-2,6-dione
1,4-ditert-butylpiperidine-2,6-dione (PubChem CID 23591871) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 1,4-ditert-butylpiperidine-2,6-dione.
Molecular Properties
| Compound Name | 1,4-ditert-butylpiperidine-2,6-dione |
| PubChem CID | 23591871 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1,4-ditert-butylpiperidine-2,6-dione |
| SMILES | CC(C)(C)C1CC(=O)N(C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C13H23NO2/c1-12(2,3)9-7-10(15)14(11(16)8-9)13(4,5)6/h9H,7-8H2,1-6H3 |
| InChIKey | KWRLCCFVTQQYQU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-ditert-butylpiperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylpiperidine-2,6-dione?
The IUPAC name of 1,4-ditert-butylpiperidine-2,6-dione (CID 23591871) is 1,4-ditert-butylpiperidine-2,6-dione.
What is the SMILES notation for 1,4-ditert-butylpiperidine-2,6-dione?
The canonical SMILES for 1,4-ditert-butylpiperidine-2,6-dione is CC(C)(C)C1CC(=O)N(C(C)(C)C)C(=O)C1.
What is the InChIKey of 1,4-ditert-butylpiperidine-2,6-dione?
The InChIKey is KWRLCCFVTQQYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-12(2,3)9-7-10(15)14(11(16)8-9)13(4,5)6/h9H,7-8H2,1-6H3.
What are the key properties of 1,4-ditert-butylpiperidine-2,6-dione?
1,4-ditert-butylpiperidine-2,6-dione has a molecular weight of 225.33 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylpiperidine-2,6-dione is sourced from PubChem (CID 23591871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).