About 2,5-ditert-butylthiazinane 1,1-dioxide
2,5-ditert-butylthiazinane 1,1-dioxide (PubChem CID 23591909) has the molecular formula C12H25NO2S
and a molecular weight of 247.40 g/mol. Its IUPAC name is 2,5-ditert-butylthiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 2,5-ditert-butylthiazinane 1,1-dioxide |
| PubChem CID | 23591909 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2,5-ditert-butylthiazinane 1,1-dioxide |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C)S(=O)(=O)C1 |
| InChI | InChI=1S/C12H25NO2S/c1-11(2,3)10-7-8-13(12(4,5)6)16(14,15)9-10/h10H,7-9H2,1-6H3 |
| InChIKey | OMDOGZFTYCDJOB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-ditert-butylthiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butylthiazinane 1,1-dioxide?
The IUPAC name of 2,5-ditert-butylthiazinane 1,1-dioxide (CID 23591909) is 2,5-ditert-butylthiazinane 1,1-dioxide.
What is the SMILES notation for 2,5-ditert-butylthiazinane 1,1-dioxide?
The canonical SMILES for 2,5-ditert-butylthiazinane 1,1-dioxide is CC(C)(C)C1CCN(C(C)(C)C)S(=O)(=O)C1.
What is the InChIKey of 2,5-ditert-butylthiazinane 1,1-dioxide?
The InChIKey is OMDOGZFTYCDJOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2S/c1-11(2,3)10-7-8-13(12(4,5)6)16(14,15)9-10/h10H,7-9H2,1-6H3.
What are the key properties of 2,5-ditert-butylthiazinane 1,1-dioxide?
2,5-ditert-butylthiazinane 1,1-dioxide has a molecular weight of 247.40 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butylthiazinane 1,1-dioxide is sourced from PubChem (CID 23591909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).