C16H27NO2 — CID 23592069
3,4-ditert-butyl-1,6-dimethyl-2H-azepine-5,7-dione (PubChem CID 23592069) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 3,4-ditert-butyl-1,6-dimethyl-2H-azepine-5,7-dione.
| Compound Name | 3,4-ditert-butyl-1,6-dimethyl-2H-azepine-5,7-dione |
|---|---|
| PubChem CID | 23592069 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 3,4-ditert-butyl-1,6-dimethyl-2H-azepine-5,7-dione |
| SMILES | CC1C(=O)C(C(C)(C)C)=C(C(C)(C)C)CN(C)C1=O |
| InChI | InChI=1S/C16H27NO2/c1-10-13(18)12(16(5,6)7)11(15(2,3)4)9-17(8)14(10)19/h10H,9H2,1-8H3 |
| InChIKey | WPLBJAGUHJZJLK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|