C14H23NO3 — CID 23592126
6,7-ditert-butyl-4-methyl-1,4-oxazepine-3,5-dione (PubChem CID 23592126) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 6,7-ditert-butyl-4-methyl-1,4-oxazepine-3,5-dione.
| Compound Name | 6,7-ditert-butyl-4-methyl-1,4-oxazepine-3,5-dione |
|---|---|
| PubChem CID | 23592126 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 6,7-ditert-butyl-4-methyl-1,4-oxazepine-3,5-dione |
| SMILES | CN1C(=O)COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H23NO3/c1-13(2,3)10-11(14(4,5)6)18-8-9(16)15(7)12(10)17/h8H2,1-7H3 |
| InChIKey | CCRGUWQHZVOVSY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|