About 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol
2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol (PubChem CID 23592585) has the molecular formula C23H32O2
and a molecular weight of 340.51 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol |
| PubChem CID | 23592585 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol |
| SMILES | Cc1ccc(C(O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1C |
| InChI | InChI=1S/C23H32O2/c1-14-9-10-16(11-15(14)2)20(24)18-12-17(22(3,4)5)13-19(21(18)25)23(6,7)8/h9-13,20,24-25H,1-8H3 |
| InChIKey | ALQGWCBZWOYALC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol?
The IUPAC name of 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol (CID 23592585) is 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol.
What is the SMILES notation for 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol?
The canonical SMILES for 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol is Cc1ccc(C(O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1C.
What is the InChIKey of 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol?
The InChIKey is ALQGWCBZWOYALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32O2/c1-14-9-10-16(11-15(14)2)20(24)18-12-17(22(3,4)5)13-19(21(18)25)23(6,7)8/h9-13,20,24-25H,1-8H3.
What are the key properties of 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol?
2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol has a molecular weight of 340.51 g/mol, XLogP of 5.69, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-6-[(3,4-dimethylphenyl)-hydroxymethyl]phenol is sourced from PubChem (CID 23592585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).