C16H36N4O3 — CID 23592606
1-[2-(2-aminoethylamino)ethylamino]-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol (PubChem CID 23592606) has the molecular formula C16H36N4O3 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-[2-(2-aminoethylamino)ethylamino]-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol.
| Compound Name | 1-[2-(2-aminoethylamino)ethylamino]-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 23592606 |
| Molecular Formula | C16H36N4O3 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 1-[2-(2-aminoethylamino)ethylamino]-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol |
| SMILES | CC1(C)CC(OCC(O)CNCCNCCN)CC(C)(C)N1O |
| InChI | InChI=1S/C16H36N4O3/c1-15(2)9-14(10-16(3,4)20(15)22)23-12-13(21)11-19-8-7-18-6-5-17/h13-14,18-19,21-22H,5-12,17H2,1-4H3 |
| InChIKey | HKIBTCPLLJHIPX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|