C33H38N6O8 — CID 23592974
N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoylamino]pentanediamide (PubChem CID 23592974) has the molecular formula C33H38N6O8 and a molecular weight of 646.70 g/mol. Its IUPAC name is N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoylamino]pentanediamide.
| Compound Name | N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoylamino]pentanediamide |
|---|---|
| PubChem CID | 23592974 |
| Molecular Formula | C33H38N6O8 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoylamino]pentanediamide |
| SMILES | COc1ccc2cc(C(=O)NCCCCCC(=O)NC(CCC(N)=O)C(=O)NC(Cc3c[nH]c4ccccc34)C(N)=O)c(=O)oc2c1 |
| InChI | InChI=1S/C33H38N6O8/c1-46-21-11-10-19-15-23(33(45)47-27(19)17-21)31(43)36-14-6-2-3-9-29(41)38-25(12-13-28(34)40)32(44)39-26(30(35)42)16-20-18-37-24-8-5-4-7-22(20)24/h4-5,7-8,10-11,15,17-18,25-26,37H,2-3,6,9,12-14,16H2,1H3,(H2,34,40)(H2,35,42)(H,36,43)(H,38,41)(H,39,44) |
| InChIKey | CCRLJOZFSMZMBT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 228.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|