C18H21NO2S — CID 2359298
1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 2359298) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 2359298 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCc3ccccc32)c1C |
| InChI | InChI=1S/C18H21NO2S/c1-12-11-13(2)15(4)18(14(12)3)22(20,21)19-10-9-16-7-5-6-8-17(16)19/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | GLNJGYWLQSBXPA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |