About N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine
N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine (PubChem CID 23593176) has the molecular formula C20H16FNS
and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine |
| PubChem CID | 23593176 |
| Molecular Formula | C20H16FNS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine |
| SMILES | Cc1ccc2c(c1)sc1cc(N(C)c3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C20H16FNS/c1-13-3-9-17-18-10-8-16(12-20(18)23-19(17)11-13)22(2)15-6-4-14(21)5-7-15/h3-12H,1-2H3 |
| InChIKey | RIAPGLMQDMKPQA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine?
The IUPAC name of N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine (CID 23593176) is N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine.
What is the SMILES notation for N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine?
The canonical SMILES for N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine is Cc1ccc2c(c1)sc1cc(N(C)c3ccc(F)cc3)ccc12.
What is the InChIKey of N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine?
The InChIKey is RIAPGLMQDMKPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FNS/c1-13-3-9-17-18-10-8-16(12-20(18)23-19(17)11-13)22(2)15-6-4-14(21)5-7-15/h3-12H,1-2H3.
What are the key properties of N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine?
N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine has a molecular weight of 321.42 g/mol, XLogP of 6.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N,7-dimethyldibenzothiophen-3-amine is sourced from PubChem (CID 23593176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).