About (4-iminocyclohexa-2,5-dien-1-ylidene)azanide
(4-iminocyclohexa-2,5-dien-1-ylidene)azanide (PubChem CID 23594381) has the molecular formula C6H5N2-
and a molecular weight of 105.12 g/mol. Its IUPAC name is (4-iminocyclohexa-2,5-dien-1-ylidene)azanide.
Molecular Properties
| Compound Name | (4-iminocyclohexa-2,5-dien-1-ylidene)azanide |
| PubChem CID | 23594381 |
| Molecular Formula | C6H5N2- |
| Molecular Weight | 105.12 g/mol |
| Exact Mass | 105.05 |
| IUPAC Name | (4-iminocyclohexa-2,5-dien-1-ylidene)azanide |
| SMILES | [H]N=C1C=CC(=[N-])C=C1 |
| InChI | InChI=1S/C6H5N2/c7-5-1-2-6(8)4-3-5/h1-4,7H/q-1 |
| InChIKey | HWPQWCPUKDLOOQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-iminocyclohexa-2,5-dien-1-ylidene)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iminocyclohexa-2,5-dien-1-ylidene)azanide?
The IUPAC name of (4-iminocyclohexa-2,5-dien-1-ylidene)azanide (CID 23594381) is (4-iminocyclohexa-2,5-dien-1-ylidene)azanide.
What is the SMILES notation for (4-iminocyclohexa-2,5-dien-1-ylidene)azanide?
The canonical SMILES for (4-iminocyclohexa-2,5-dien-1-ylidene)azanide is [H]N=C1C=CC(=[N-])C=C1.
What is the InChIKey of (4-iminocyclohexa-2,5-dien-1-ylidene)azanide?
The InChIKey is HWPQWCPUKDLOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N2/c7-5-1-2-6(8)4-3-5/h1-4,7H/q-1.
What are the key properties of (4-iminocyclohexa-2,5-dien-1-ylidene)azanide?
(4-iminocyclohexa-2,5-dien-1-ylidene)azanide has a molecular weight of 105.12 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iminocyclohexa-2,5-dien-1-ylidene)azanide is sourced from PubChem (CID 23594381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).