C36H49N5O8S — CID 23595418
hexyl N-[1-[2-[[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-isoquinolin-1-yloxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 23595418) has the molecular formula C36H49N5O8S and a molecular weight of 711.88 g/mol. Its IUPAC name is hexyl N-[1-[2-[[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-isoquinolin-1-yloxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | hexyl N-[1-[2-[[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-isoquinolin-1-yloxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 23595418 |
| Molecular Formula | C36H49N5O8S |
| Molecular Weight | 711.88 g/mol |
| Exact Mass | 711.33 |
| IUPAC Name | hexyl N-[1-[2-[[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-isoquinolin-1-yloxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CC1CC1(NC(=O)C1CC(Oc2nccc3ccccc23)CN1C(=O)C(NC(=O)OCCCCCC)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C36H49N5O8S/c1-6-8-9-12-19-48-34(45)38-29(35(3,4)5)32(43)41-22-25(49-31-27-14-11-10-13-23(27)17-18-37-31)20-28(41)30(42)39-36(21-24(36)7-2)33(44)40-50(46,47)26-15-16-26/h7,10-11,13-14,17-18,24-26,28-29H,2,6,8-9,12,15-16,19-22H2,1,3-5H3,(H,38,45)(H,39,42)(H,40,44) |
| InChIKey | DJWCRTBXFFPWNW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 173.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|