About 2-amino-N-ethyl-N,3-dimethylpentanamide
2-amino-N-ethyl-N,3-dimethylpentanamide (PubChem CID 23595882) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-amino-N-ethyl-N,3-dimethylpentanamide.
Molecular Properties
| Compound Name | 2-amino-N-ethyl-N,3-dimethylpentanamide |
| PubChem CID | 23595882 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2-amino-N-ethyl-N,3-dimethylpentanamide |
| SMILES | CCC(C)C(N)C(=O)N(C)CC |
| InChI | InChI=1S/C9H20N2O/c1-5-7(3)8(10)9(12)11(4)6-2/h7-8H,5-6,10H2,1-4H3 |
| InChIKey | IUVAYAARSQMGGM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-ethyl-N,3-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-ethyl-N,3-dimethylpentanamide?
The IUPAC name of 2-amino-N-ethyl-N,3-dimethylpentanamide (CID 23595882) is 2-amino-N-ethyl-N,3-dimethylpentanamide.
What is the SMILES notation for 2-amino-N-ethyl-N,3-dimethylpentanamide?
The canonical SMILES for 2-amino-N-ethyl-N,3-dimethylpentanamide is CCC(C)C(N)C(=O)N(C)CC.
What is the InChIKey of 2-amino-N-ethyl-N,3-dimethylpentanamide?
The InChIKey is IUVAYAARSQMGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-5-7(3)8(10)9(12)11(4)6-2/h7-8H,5-6,10H2,1-4H3.
What are the key properties of 2-amino-N-ethyl-N,3-dimethylpentanamide?
2-amino-N-ethyl-N,3-dimethylpentanamide has a molecular weight of 172.27 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-ethyl-N,3-dimethylpentanamide is sourced from PubChem (CID 23595882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).