C32H27N5O3 — CID 23596283
N-[5-(1,3-dimethylisoquinolin-5-yl)-1H-imidazol-2-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596283) has the molecular formula C32H27N5O3 and a molecular weight of 529.60 g/mol. Its IUPAC name is N-[5-(1,3-dimethylisoquinolin-5-yl)-1H-imidazol-2-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[5-(1,3-dimethylisoquinolin-5-yl)-1H-imidazol-2-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596283 |
| Molecular Formula | C32H27N5O3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N-[5-(1,3-dimethylisoquinolin-5-yl)-1H-imidazol-2-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1cc2c(-c3cnc(NC(=O)C4(C)CC5([N+](=O)[O-])c6ccccc6C4c4ccccc45)[nH]3)cccc2c(C)n1 |
| InChI | InChI=1S/C32H27N5O3/c1-18-15-24-20(19(2)34-18)11-8-12-21(24)27-16-33-30(35-27)36-29(38)31(3)17-32(37(39)40)25-13-6-4-9-22(25)28(31)23-10-5-7-14-26(23)32/h4-16,28H,17H2,1-3H3,(H2,33,35,36,38) |
| InChIKey | ACYXIRZKAGVPNH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|