C33H29N3O — CID 23596287
8,15-dimethyl-N-[5-(4-methylnaphthalen-1-yl)-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596287) has the molecular formula C33H29N3O and a molecular weight of 483.62 g/mol. Its IUPAC name is 8,15-dimethyl-N-[5-(4-methylnaphthalen-1-yl)-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 8,15-dimethyl-N-[5-(4-methylnaphthalen-1-yl)-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596287 |
| Molecular Formula | C33H29N3O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 8,15-dimethyl-N-[5-(4-methylnaphthalen-1-yl)-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1ccc(-c2cnc(NC(=O)C3(C)CC4(C)c5ccccc5C3c3ccccc34)[nH]2)c2ccccc12 |
| InChI | InChI=1S/C33H29N3O/c1-20-16-17-23(22-11-5-4-10-21(20)22)28-18-34-31(35-28)36-30(37)33(3)19-32(2)26-14-8-6-12-24(26)29(33)25-13-7-9-15-27(25)32/h4-18,29H,19H2,1-3H3,(H2,34,35,36,37) |
| InChIKey | OZICYZVCWLOKHY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |