C23H22N2OS — CID 23596330
N-(4,5-dimethyl-1,3-thiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596330) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596330 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1nc(NC(=O)C2(C)CC3c4ccccc4C2c2ccccc23)sc1C |
| InChI | InChI=1S/C23H22N2OS/c1-13-14(2)27-22(24-13)25-21(26)23(3)12-19-15-8-4-6-10-17(15)20(23)18-11-7-5-9-16(18)19/h4-11,19-20H,12H2,1-3H3,(H,24,25,26) |
| InChIKey | WNJJVXQAJXMKMQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |