C26H30 — CID 23596899
1,4,5,6,7,10,11,12-octamethyl-2,3-dihydrotetracene (PubChem CID 23596899) has the molecular formula C26H30 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,4,5,6,7,10,11,12-octamethyl-2,3-dihydrotetracene.
| Compound Name | 1,4,5,6,7,10,11,12-octamethyl-2,3-dihydrotetracene |
|---|---|
| PubChem CID | 23596899 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1,4,5,6,7,10,11,12-octamethyl-2,3-dihydrotetracene |
| SMILES | CC1=c2c(C)c3c(C)c4c(C)ccc(C)c4c(C)c3c(C)c2=C(C)CC1 |
| InChI | InChI=1S/C26H30/c1-13-9-10-14(2)22-18(6)26-20(8)24-16(4)12-11-15(3)23(24)19(7)25(26)17(5)21(13)22/h9-10H,11-12H2,1-8H3 |
| InChIKey | LXUJCGXZYMVGDY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|