C28H43NO4S — CID 23597276
(13E)-4-hydroxy-5,5,7,8,9,15-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 23597276) has the molecular formula C28H43NO4S and a molecular weight of 489.72 g/mol. Its IUPAC name is (13E)-4-hydroxy-5,5,7,8,9,15-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13E)-4-hydroxy-5,5,7,8,9,15-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 23597276 |
| Molecular Formula | C28H43NO4S |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (13E)-4-hydroxy-5,5,7,8,9,15-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1OC(=O)CC(O)C(C)(C)C(=O)C(C)C(C)C(C)CCC/C=C/C1C |
| InChI | InChI=1S/C28H43NO4S/c1-17-12-10-9-11-13-18(2)26(19(3)14-23-16-34-22(6)29-23)33-25(31)15-24(30)28(7,8)27(32)21(5)20(17)4/h11,13-14,16-18,20-21,24,26,30H,9-10,12,15H2,1-8H3/b13-11+,19-14+ |
| InChIKey | QJWGCCTYRTYWAC-DCODIGEKSA-N |
| XLogP | 6.40 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|