About 8-bromo-4H-isochromene-1,3-dione
8-bromo-4H-isochromene-1,3-dione (PubChem CID 23597432) has the molecular formula C9H5BrO3
and a molecular weight of 241.04 g/mol. Its IUPAC name is 8-bromo-4H-isochromene-1,3-dione.
Molecular Properties
| Compound Name | 8-bromo-4H-isochromene-1,3-dione |
| PubChem CID | 23597432 |
| Molecular Formula | C9H5BrO3 |
| Molecular Weight | 241.04 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | 8-bromo-4H-isochromene-1,3-dione |
| SMILES | O=C1Cc2cccc(Br)c2C(=O)O1 |
| InChI | InChI=1S/C9H5BrO3/c10-6-3-1-2-5-4-7(11)13-9(12)8(5)6/h1-3H,4H2 |
| InChIKey | YDEVUDHZLVGDBS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.04 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-4H-isochromene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4H-isochromene-1,3-dione?
The IUPAC name of 8-bromo-4H-isochromene-1,3-dione (CID 23597432) is 8-bromo-4H-isochromene-1,3-dione.
What is the SMILES notation for 8-bromo-4H-isochromene-1,3-dione?
The canonical SMILES for 8-bromo-4H-isochromene-1,3-dione is O=C1Cc2cccc(Br)c2C(=O)O1.
What is the InChIKey of 8-bromo-4H-isochromene-1,3-dione?
The InChIKey is YDEVUDHZLVGDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrO3/c10-6-3-1-2-5-4-7(11)13-9(12)8(5)6/h1-3H,4H2.
What are the key properties of 8-bromo-4H-isochromene-1,3-dione?
8-bromo-4H-isochromene-1,3-dione has a molecular weight of 241.04 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4H-isochromene-1,3-dione is sourced from PubChem (CID 23597432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).