About (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate
(2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate (PubChem CID 23597896) has the molecular formula C11H18O5S
and a molecular weight of 262.33 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate |
| PubChem CID | 23597896 |
| Molecular Formula | C11H18O5S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate |
| SMILES | CC(C)(CSCCO)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C11H18O5S/c1-11(2,7-17-6-4-12)10(14)16-8-3-5-15-9(8)13/h8,12H,3-7H2,1-2H3 |
| InChIKey | ZUOKTDWFPUOTPV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
The IUPAC name of (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate (CID 23597896) is (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
The canonical SMILES for (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate is CC(C)(CSCCO)C(=O)OC1CCOC1=O.
What is the InChIKey of (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
The InChIKey is ZUOKTDWFPUOTPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5S/c1-11(2,7-17-6-4-12)10(14)16-8-3-5-15-9(8)13/h8,12H,3-7H2,1-2H3.
What are the key properties of (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
(2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate has a molecular weight of 262.33 g/mol, XLogP of 0.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate is sourced from PubChem (CID 23597896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).