About (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate
(4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate (PubChem CID 23597898) has the molecular formula C13H22O5S
and a molecular weight of 290.38 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate |
| PubChem CID | 23597898 |
| Molecular Formula | C13H22O5S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate |
| SMILES | CC(C)(CSCCO)C(=O)OC1C(=O)OCC1(C)C |
| InChI | InChI=1S/C13H22O5S/c1-12(2)7-17-10(15)9(12)18-11(16)13(3,4)8-19-6-5-14/h9,14H,5-8H2,1-4H3 |
| InChIKey | VWMOQOXDFHVWRS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
The IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate (CID 23597898) is (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate.
What is the SMILES notation for (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
The canonical SMILES for (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate is CC(C)(CSCCO)C(=O)OC1C(=O)OCC1(C)C.
What is the InChIKey of (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
The InChIKey is VWMOQOXDFHVWRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O5S/c1-12(2)7-17-10(15)9(12)18-11(16)13(3,4)8-19-6-5-14/h9,14H,5-8H2,1-4H3.
What are the key properties of (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate?
(4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate has a molecular weight of 290.38 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2-oxooxolan-3-yl) 3-(2-hydroxyethylsulfanyl)-2,2-dimethylpropanoate is sourced from PubChem (CID 23597898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).