C16H18F12O4 — CID 23597951
2-[3-ethenoxy-5-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 23597951) has the molecular formula C16H18F12O4 and a molecular weight of 502.29 g/mol. Its IUPAC name is 2-[3-ethenoxy-5-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-ethenoxy-5-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 23597951 |
| Molecular Formula | C16H18F12O4 |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-[3-ethenoxy-5-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=COC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(OCOC)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H18F12O4/c1-3-31-10-5-8(11(29,13(17,18)19)14(20,21)22)4-9(6-10)12(15(23,24)25,16(26,27)28)32-7-30-2/h3,8-10,29H,1,4-7H2,2H3 |
| InChIKey | OZICPQIVWTUQAH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|