C18H19F15O4 — CID 23597956
[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 23597956) has the molecular formula C18H19F15O4 and a molecular weight of 584.32 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 23597956 |
| Molecular Formula | C18H19F15O4 |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C18H19F15O4/c1-3-11(2,14(19,20)21)10(34)37-9-5-7(12(35,15(22,23)24)16(25,26)27)4-8(6-9)13(36,17(28,29)30)18(31,32)33/h7-9,35-36H,3-6H2,1-2H3 |
| InChIKey | VJBBVORUYZWEFU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |