C24H45N3O4S2Si2 — CID 23598369
S-[1-[4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate (PubChem CID 23598369) has the molecular formula C24H45N3O4S2Si2 and a molecular weight of 559.95 g/mol. Its IUPAC name is S-[1-[4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate.
| Compound Name | S-[1-[4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 23598369 |
| Molecular Formula | C24H45N3O4S2Si2 |
| Molecular Weight | 559.95 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | S-[1-[4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylcarbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CN(c2nc(C(=O)NC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)cs2)C1 |
| InChI | InChI=1S/C24H45N3O4S2Si2/c1-17(28)33-19-12-27(13-19)22-26-20(16-32-22)21(29)25-18(14-30-34(8,9)23(2,3)4)15-31-35(10,11)24(5,6)7/h16,18-19H,12-15H2,1-11H3,(H,25,29) |
| InChIKey | BABJUBMBKQPFLY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.95 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|