About 8-azaspiro[5.6]dodeca-4,10-diene
8-azaspiro[5.6]dodeca-4,10-diene (PubChem CID 23598605) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 8-azaspiro[5.6]dodeca-4,10-diene.
Molecular Properties
| Compound Name | 8-azaspiro[5.6]dodeca-4,10-diene |
| PubChem CID | 23598605 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 8-azaspiro[5.6]dodeca-4,10-diene |
| SMILES | C1=CC2(CC=CCNC2)CCC1 |
| InChI | InChI=1S/C11H17N/c1-2-6-11(7-3-1)8-4-5-9-12-10-11/h2,4-6,12H,1,3,7-10H2 |
| InChIKey | RUUOZHKEWWKJCR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-azaspiro[5.6]dodeca-4,10-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azaspiro[5.6]dodeca-4,10-diene?
The IUPAC name of 8-azaspiro[5.6]dodeca-4,10-diene (CID 23598605) is 8-azaspiro[5.6]dodeca-4,10-diene.
What is the SMILES notation for 8-azaspiro[5.6]dodeca-4,10-diene?
The canonical SMILES for 8-azaspiro[5.6]dodeca-4,10-diene is C1=CC2(CC=CCNC2)CCC1.
What is the InChIKey of 8-azaspiro[5.6]dodeca-4,10-diene?
The InChIKey is RUUOZHKEWWKJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-2-6-11(7-3-1)8-4-5-9-12-10-11/h2,4-6,12H,1,3,7-10H2.
What are the key properties of 8-azaspiro[5.6]dodeca-4,10-diene?
8-azaspiro[5.6]dodeca-4,10-diene has a molecular weight of 163.26 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azaspiro[5.6]dodeca-4,10-diene is sourced from PubChem (CID 23598605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).