About methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate
methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate (PubChem CID 23598686) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate |
| PubChem CID | 23598686 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate |
| SMILES | COC(=O)CN1CC=CCC(N)C1=O |
| InChI | InChI=1S/C9H14N2O3/c1-14-8(12)6-11-5-3-2-4-7(10)9(11)13/h2-3,7H,4-6,10H2,1H3 |
| InChIKey | IATUSMWPTLNHQO-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate?
The IUPAC name of methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate (CID 23598686) is methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate.
What is the SMILES notation for methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate?
The canonical SMILES for methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate is COC(=O)CN1CC=CCC(N)C1=O.
What is the InChIKey of methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate?
The InChIKey is IATUSMWPTLNHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-14-8(12)6-11-5-3-2-4-7(10)9(11)13/h2-3,7H,4-6,10H2,1H3.
What are the key properties of methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate?
methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate has a molecular weight of 198.22 g/mol, XLogP of -0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-amino-7-oxo-5,6-dihydro-2H-azepin-1-yl)acetate is sourced from PubChem (CID 23598686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).