C21H15FIN5O3 — CID 23599018
(1S,6R,7S)-4-(4-cyano-3-iodophenyl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 23599018) has the molecular formula C21H15FIN5O3 and a molecular weight of 531.29 g/mol. Its IUPAC name is (1S,6R,7S)-4-(4-cyano-3-iodophenyl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1S,6R,7S)-4-(4-cyano-3-iodophenyl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 23599018 |
| Molecular Formula | C21H15FIN5O3 |
| Molecular Weight | 531.29 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | (1S,6R,7S)-4-(4-cyano-3-iodophenyl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | N#Cc1ccc(N2C(=O)[C@H]3[C@@H]4C[C@@H](CN4C(=O)Nc4ccc(F)cc4)N3C2=O)cc1I |
| InChI | InChI=1S/C21H15FIN5O3/c22-12-2-4-13(5-3-12)25-20(30)26-10-15-8-17(26)18-19(29)28(21(31)27(15)18)14-6-1-11(9-24)16(23)7-14/h1-7,15,17-18H,8,10H2,(H,25,30)/t15-,17-,18+/m0/s1 |
| InChIKey | DREVACZNUGPJPT-RYQLBKOJSA-N |
| XLogP | 3.13 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|