C19H16ClN5O2S — CID 23599069
(1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide (PubChem CID 23599069) has the molecular formula C19H16ClN5O2S and a molecular weight of 413.89 g/mol. Its IUPAC name is (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide.
| Compound Name | (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
|---|---|
| PubChem CID | 23599069 |
| Molecular Formula | C19H16ClN5O2S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-prop-2-ynyl-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
| SMILES | C#CCNC(=S)N1C[C@@H]2C[C@H]1[C@H]1C(=O)N(c3ccc(C#N)c(Cl)c3C)C(=O)N21 |
| InChI | InChI=1S/C19H16ClN5O2S/c1-3-6-22-18(28)23-9-12-7-14(23)16-17(26)25(19(27)24(12)16)13-5-4-11(8-21)15(20)10(13)2/h1,4-5,12,14,16H,6-7,9H2,2H3,(H,22,28)/t12-,14-,16-/m0/s1 |
| InChIKey | PZJIAJQTUZJLTJ-NOLJZWGESA-N |
| XLogP | 1.62 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|