C22H16ClF2N5O2S — CID 23599078
(1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(2,6-difluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide (PubChem CID 23599078) has the molecular formula C22H16ClF2N5O2S and a molecular weight of 487.92 g/mol. Its IUPAC name is (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(2,6-difluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide.
| Compound Name | (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(2,6-difluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
|---|---|
| PubChem CID | 23599078 |
| Molecular Formula | C22H16ClF2N5O2S |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(2,6-difluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@@H]4C[C@@H](CN4C(=S)Nc4c(F)cccc4F)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C22H16ClF2N5O2S/c1-10-15(6-5-11(8-26)17(10)23)30-20(31)19-16-7-12(29(19)22(30)32)9-28(16)21(33)27-18-13(24)3-2-4-14(18)25/h2-6,12,16,19H,7,9H2,1H3,(H,27,33)/t12-,16-,19-/m0/s1 |
| InChIKey | OBHPPFZKLXRNDY-UVIMBBFXSA-N |
| XLogP | 3.79 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|