C23H17ClF3N5O2S — CID 23599275
4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide (PubChem CID 23599275) has the molecular formula C23H17ClF3N5O2S and a molecular weight of 519.94 g/mol. Its IUPAC name is 4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide.
| Compound Name | 4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
|---|---|
| PubChem CID | 23599275 |
| Molecular Formula | C23H17ClF3N5O2S |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-N-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
| SMILES | Cc1c(N2C(=O)C3C4CC(CN4C(=S)Nc4cccc(C(F)(F)F)c4)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C23H17ClF3N5O2S/c1-11-16(6-5-12(9-28)18(11)24)32-20(33)19-17-8-15(31(19)22(32)34)10-30(17)21(35)29-14-4-2-3-13(7-14)23(25,26)27/h2-7,15,17,19H,8,10H2,1H3,(H,29,35) |
| InChIKey | PZXYFKAPCAOPEX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|