About ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate
ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 23599383) has the molecular formula C17H19N3O4
and a molecular weight of 329.36 g/mol. Its IUPAC name is ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| PubChem CID | 23599383 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | CCOC(=O)C1C2CCC(C2)N1C(=O)Nc1noc2ccccc12 |
| InChI | InChI=1S/C17H19N3O4/c1-2-23-16(21)14-10-7-8-11(9-10)20(14)17(22)18-15-12-5-3-4-6-13(12)24-19-15/h3-6,10-11,14H,2,7-9H2,1H3,(H,18,19,22) |
| InChIKey | RNLOYXYBSBUDLP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate?
The IUPAC name of ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate (CID 23599383) is ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate.
What is the SMILES notation for ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate?
The canonical SMILES for ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate is CCOC(=O)C1C2CCC(C2)N1C(=O)Nc1noc2ccccc12.
What is the InChIKey of ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate?
The InChIKey is RNLOYXYBSBUDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O4/c1-2-23-16(21)14-10-7-8-11(9-10)20(14)17(22)18-15-12-5-3-4-6-13(12)24-19-15/h3-6,10-11,14H,2,7-9H2,1H3,(H,18,19,22).
What are the key properties of ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate?
ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate has a molecular weight of 329.36 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,2-benzoxazol-3-ylcarbamoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate is sourced from PubChem (CID 23599383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).