C20H20Cl2N2O — CID 23599460
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-(3,5-dichlorophenyl)benzamide (PubChem CID 23599460) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-(3,5-dichlorophenyl)benzamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-(3,5-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 23599460 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-(3,5-dichlorophenyl)benzamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1cccc(-c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C20H20Cl2N2O/c21-17-9-16(10-18(22)11-17)14-2-1-3-15(8-14)20(25)23-19-12-24-6-4-13(19)5-7-24/h1-3,8-11,13,19H,4-7,12H2,(H,23,25)/t19-/m0/s1 |
| InChIKey | WTUHRGRJMXKQOM-IBGZPJMESA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |